Description

A C-nitro compound consisting of uracil having a nitro group at the 5-position.

Chemical properties

Chemical formula Net charge Average mass
C4H3N3O4 0 157.08430
5-nitrouracil

Nomenclature

IUPAC SMILES
5-nitropyrimidine-2,4(1H,3H)-dione [O-][N+](=O)c1c[nH]c(=O)[nH]c1=O