Chemical properties

Chemical formula Net charge Average mass
C5H3N2O4 -1 155.08830
orotate

Nomenclature

IUPAC SMILES
2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate [O-]C(=O)c1cc(=O)[nH]c(=O)[nH]1