Chemical properties

Chemical formula Net charge Average mass
C10H13N5O 0 219.24332
zeatin

Nomenclature

IUPAC SMILES
2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-ol [H]C(CNc1ncnc2[nH]cnc12)=C(C)CO