A pyrimidone that is uracil in which positions 1, 5, and 6 are substituted by ethoxymethyl, isopropyl, and cyclohexylsulfanyl groups, respectively.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C16H26N2O3S | 0 | 326.45400 |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 6-(cyclohexylsulfanyl)-1-(ethoxymethyl)-5-(propan-2-yl)pyrimidine-2,4(1H,3H)-dione | CCOCn1c(SC2CCCCC2)c(C(C)C)c(=O)[nH]c1=O | InChI=1S/C16H26N2O3S/c1-4-21-10-18-15(22-12-8-6-5-7-9-12)13(11(2)3)14(19)17-16(18)20/h11-12H,4-10H2,1-3H3,(H,17,19,20) | JKXLRLDPSLZEDD-UHFFFAOYSA-N |
|