A 6-alkylaminopurine that is 9H-purin-6-amine substituted by a methyl group at the amino nitrogen.
Chemical formula | Net charge | Average mass |
---|---|---|
C6H7N5 | 0 | 149.15330 |
Name | 6-methyladenine |
---|---|
Abbreviation | 6mA |
Symbol | a |
IUPAC | SMILES | InChI | InChIKey | Synonyms |
---|---|---|---|---|
N-methyl-9H-purin-6-amine | CNc1ncnc2[nH]cnc12 | InChI=1S/C6H7N5/c1-7-5-4-6(10-2-8-4)11-3-9-5/h2-3H,1H3,(H2,7,8,9,10,11) | CKOMXBHMKXXTNW-UHFFFAOYSA-N |
|
Method | Method detail | Resolution |
Qualifier
|
References |
---|---|---|---|---|
SMRT | direct detection | single-base | target sequences |
|
dye-terminator Sanger sequencing | direct detection | single-base |
|
Origin | Function | Functional detail |
Organisms
|
References |
---|---|---|---|---|
natural | epigenetic mark |
|
|